C19H23N3OS — CID 112825951
N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-3-(3-phenyl-1,2,4-oxadiazol-5-yl)propan-1-amine (PubChem CID 112825951) has the molecular formula C19H23N3OS and a molecular weight of 341.48 g/mol. Its IUPAC name is N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-3-(3-phenyl-1,2,4-oxadiazol-5-yl)propan-1-amine.
| Compound Name | N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-3-(3-phenyl-1,2,4-oxadiazol-5-yl)propan-1-amine |
|---|---|
| PubChem CID | 112825951 |
| Molecular Formula | C19H23N3OS |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-3-(3-phenyl-1,2,4-oxadiazol-5-yl)propan-1-amine |
| SMILES | Cc1cc(C(C)NCCCc2nc(-c3ccccc3)no2)c(C)s1 |
| InChI | InChI=1S/C19H23N3OS/c1-13-12-17(15(3)24-13)14(2)20-11-7-10-18-21-19(22-23-18)16-8-5-4-6-9-16/h4-6,8-9,12,14,20H,7,10-11H2,1-3H3 |
| InChIKey | LBJVEPCGIISRQY-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|