C14H22N4O2S2 — CID 99852270
2,5-dimethyl-N-[2-[[(1R)-1-(5-methyl-1H-pyrazol-4-yl)ethyl]amino]ethyl]thiophene-3-sulfonamide (PubChem CID 99852270) has the molecular formula C14H22N4O2S2 and a molecular weight of 342.49 g/mol. Its IUPAC name is 2,5-dimethyl-N-[2-[[(1R)-1-(5-methyl-1H-pyrazol-4-yl)ethyl]amino]ethyl]thiophene-3-sulfonamide.
| Compound Name | 2,5-dimethyl-N-[2-[[(1R)-1-(5-methyl-1H-pyrazol-4-yl)ethyl]amino]ethyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 99852270 |
| Molecular Formula | C14H22N4O2S2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2,5-dimethyl-N-[2-[[(1R)-1-(5-methyl-1H-pyrazol-4-yl)ethyl]amino]ethyl]thiophene-3-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCN[C@H](C)c2cn[nH]c2C)c(C)s1 |
| InChI | InChI=1S/C14H22N4O2S2/c1-9-7-14(12(4)21-9)22(19,20)17-6-5-15-10(2)13-8-16-18-11(13)3/h7-8,10,15,17H,5-6H2,1-4H3,(H,16,18)/t10-/m1/s1 |
| InChIKey | WDHWNFSYITYKNM-SNVBAGLBSA-N |
| XLogP | 2.03 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|