C14H22N4O2S2 — CID 75515433
2,5-dimethyl-N-[2-[1-(1-methylpyrazol-4-yl)ethylamino]ethyl]thiophene-3-sulfonamide (PubChem CID 75515433) has the molecular formula C14H22N4O2S2 and a molecular weight of 342.49 g/mol. Its IUPAC name is 2,5-dimethyl-N-[2-[1-(1-methylpyrazol-4-yl)ethylamino]ethyl]thiophene-3-sulfonamide.
| Compound Name | 2,5-dimethyl-N-[2-[1-(1-methylpyrazol-4-yl)ethylamino]ethyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 75515433 |
| Molecular Formula | C14H22N4O2S2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2,5-dimethyl-N-[2-[1-(1-methylpyrazol-4-yl)ethylamino]ethyl]thiophene-3-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCNC(C)c2cnn(C)c2)c(C)s1 |
| InChI | InChI=1S/C14H22N4O2S2/c1-10-7-14(12(3)21-10)22(19,20)17-6-5-15-11(2)13-8-16-18(4)9-13/h7-9,11,15,17H,5-6H2,1-4H3 |
| InChIKey | LLDRZWNDJIWBKQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|