C16H23N5O2S3 — CID 133387752
N-[2-[(6-tert-butylimidazo[2,1-b][1,3,4]thiadiazol-2-yl)amino]ethyl]-2,5-dimethylthiophene-3-sulfonamide (PubChem CID 133387752) has the molecular formula C16H23N5O2S3 and a molecular weight of 413.59 g/mol. Its IUPAC name is N-[2-[(6-tert-butylimidazo[2,1-b][1,3,4]thiadiazol-2-yl)amino]ethyl]-2,5-dimethylthiophene-3-sulfonamide.
| Compound Name | N-[2-[(6-tert-butylimidazo[2,1-b][1,3,4]thiadiazol-2-yl)amino]ethyl]-2,5-dimethylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 133387752 |
| Molecular Formula | C16H23N5O2S3 |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | N-[2-[(6-tert-butylimidazo[2,1-b][1,3,4]thiadiazol-2-yl)amino]ethyl]-2,5-dimethylthiophene-3-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCNc2nn3cc(C(C)(C)C)nc3s2)c(C)s1 |
| InChI | InChI=1S/C16H23N5O2S3/c1-10-8-12(11(2)24-10)26(22,23)18-7-6-17-14-20-21-9-13(16(3,4)5)19-15(21)25-14/h8-9,18H,6-7H2,1-5H3,(H,17,20) |
| InChIKey | YMQCZYVNIFPMCZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 88.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|