C13H15F3N4O2S2 — CID 133421554
2,5-dimethyl-N-[2-[[6-(trifluoromethyl)pyridazin-3-yl]amino]ethyl]thiophene-3-sulfonamide (PubChem CID 133421554) has the molecular formula C13H15F3N4O2S2 and a molecular weight of 380.42 g/mol. Its IUPAC name is 2,5-dimethyl-N-[2-[[6-(trifluoromethyl)pyridazin-3-yl]amino]ethyl]thiophene-3-sulfonamide.
| Compound Name | 2,5-dimethyl-N-[2-[[6-(trifluoromethyl)pyridazin-3-yl]amino]ethyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 133421554 |
| Molecular Formula | C13H15F3N4O2S2 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 2,5-dimethyl-N-[2-[[6-(trifluoromethyl)pyridazin-3-yl]amino]ethyl]thiophene-3-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCNc2ccc(C(F)(F)F)nn2)c(C)s1 |
| InChI | InChI=1S/C13H15F3N4O2S2/c1-8-7-10(9(2)23-8)24(21,22)18-6-5-17-12-4-3-11(19-20-12)13(14,15)16/h3-4,7,18H,5-6H2,1-2H3,(H,17,20) |
| InChIKey | QIWBVXCYVDBIHK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|