C15H21N3O2S2 — CID 124514744
2,5-dimethyl-N-[2-[[(1R)-1-pyridin-2-ylethyl]amino]ethyl]thiophene-3-sulfonamide (PubChem CID 124514744) has the molecular formula C15H21N3O2S2 and a molecular weight of 339.49 g/mol. Its IUPAC name is 2,5-dimethyl-N-[2-[[(1R)-1-pyridin-2-ylethyl]amino]ethyl]thiophene-3-sulfonamide.
| Compound Name | 2,5-dimethyl-N-[2-[[(1R)-1-pyridin-2-ylethyl]amino]ethyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 124514744 |
| Molecular Formula | C15H21N3O2S2 |
| Molecular Weight | 339.49 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 2,5-dimethyl-N-[2-[[(1R)-1-pyridin-2-ylethyl]amino]ethyl]thiophene-3-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCN[C@H](C)c2ccccn2)c(C)s1 |
| InChI | InChI=1S/C15H21N3O2S2/c1-11-10-15(13(3)21-11)22(19,20)18-9-8-16-12(2)14-6-4-5-7-17-14/h4-7,10,12,16,18H,8-9H2,1-3H3/t12-/m1/s1 |
| InChIKey | NAMYHRKAINDFPS-GFCCVEGCSA-N |
| XLogP | 2.39 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.49 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|