C13H23NO3S2 — CID 38256658
2,5-dimethyl-N-[3-(2-methylpropoxy)propyl]thiophene-3-sulfonamide (PubChem CID 38256658) has the molecular formula C13H23NO3S2 and a molecular weight of 305.46 g/mol. Its IUPAC name is 2,5-dimethyl-N-[3-(2-methylpropoxy)propyl]thiophene-3-sulfonamide.
| Compound Name | 2,5-dimethyl-N-[3-(2-methylpropoxy)propyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 38256658 |
| Molecular Formula | C13H23NO3S2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 2,5-dimethyl-N-[3-(2-methylpropoxy)propyl]thiophene-3-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCCOCC(C)C)c(C)s1 |
| InChI | InChI=1S/C13H23NO3S2/c1-10(2)9-17-7-5-6-14-19(15,16)13-8-11(3)18-12(13)4/h8,10,14H,5-7,9H2,1-4H3 |
| InChIKey | OVLRAFUGVLIEFE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|