C16H20N2O4S2 — CID 122032147
3-[[2-[(2,5-dimethylthiophen-3-yl)sulfonylamino]ethylamino]methyl]benzoic acid (PubChem CID 122032147) has the molecular formula C16H20N2O4S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 3-[[2-[(2,5-dimethylthiophen-3-yl)sulfonylamino]ethylamino]methyl]benzoic acid.
| Compound Name | 3-[[2-[(2,5-dimethylthiophen-3-yl)sulfonylamino]ethylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122032147 |
| Molecular Formula | C16H20N2O4S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 3-[[2-[(2,5-dimethylthiophen-3-yl)sulfonylamino]ethylamino]methyl]benzoic acid |
| SMILES | Cc1cc(S(=O)(=O)NCCNCc2cccc(C(=O)O)c2)c(C)s1 |
| InChI | InChI=1S/C16H20N2O4S2/c1-11-8-15(12(2)23-11)24(21,22)18-7-6-17-10-13-4-3-5-14(9-13)16(19)20/h3-5,8-9,17-18H,6-7,10H2,1-2H3,(H,19,20) |
| InChIKey | NSYIZYHAAPRRMM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|