C14H22N4OS — CID 133366326
6-tert-butyl-N-[2-(2-methylprop-2-enoxy)ethyl]imidazo[2,1-b][1,3,4]thiadiazol-2-amine (PubChem CID 133366326) has the molecular formula C14H22N4OS and a molecular weight of 294.42 g/mol. Its IUPAC name is 6-tert-butyl-N-[2-(2-methylprop-2-enoxy)ethyl]imidazo[2,1-b][1,3,4]thiadiazol-2-amine.
| Compound Name | 6-tert-butyl-N-[2-(2-methylprop-2-enoxy)ethyl]imidazo[2,1-b][1,3,4]thiadiazol-2-amine |
|---|---|
| PubChem CID | 133366326 |
| Molecular Formula | C14H22N4OS |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 6-tert-butyl-N-[2-(2-methylprop-2-enoxy)ethyl]imidazo[2,1-b][1,3,4]thiadiazol-2-amine |
| SMILES | C=C(C)COCCNc1nn2cc(C(C)(C)C)nc2s1 |
| InChI | InChI=1S/C14H22N4OS/c1-10(2)9-19-7-6-15-12-17-18-8-11(14(3,4)5)16-13(18)20-12/h8H,1,6-7,9H2,2-5H3,(H,15,17) |
| InChIKey | WHMDYRVMKPQBRC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|