C19H27N5OS — CID 51932499
(1S)-N'-(6-tert-butylimidazo[2,1-b][1,3,4]thiadiazol-2-yl)-1-(2-methoxyphenyl)-N,N-dimethylethane-1,2-diamine (PubChem CID 51932499) has the molecular formula C19H27N5OS and a molecular weight of 373.53 g/mol. Its IUPAC name is (1S)-N'-(6-tert-butylimidazo[2,1-b][1,3,4]thiadiazol-2-yl)-1-(2-methoxyphenyl)-N,N-dimethylethane-1,2-diamine.
| Compound Name | (1S)-N'-(6-tert-butylimidazo[2,1-b][1,3,4]thiadiazol-2-yl)-1-(2-methoxyphenyl)-N,N-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 51932499 |
| Molecular Formula | C19H27N5OS |
| Molecular Weight | 373.53 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | (1S)-N'-(6-tert-butylimidazo[2,1-b][1,3,4]thiadiazol-2-yl)-1-(2-methoxyphenyl)-N,N-dimethylethane-1,2-diamine |
| SMILES | COc1ccccc1[C@@H](CNc1nn2cc(C(C)(C)C)nc2s1)N(C)C |
| InChI | InChI=1S/C19H27N5OS/c1-19(2,3)16-12-24-18(21-16)26-17(22-24)20-11-14(23(4)5)13-9-7-8-10-15(13)25-6/h7-10,12,14H,11H2,1-6H3,(H,20,22)/t14-/m1/s1 |
| InChIKey | YLFWVOMSECJZON-CQSZACIVSA-N |
| XLogP | 3.81 |
| TPSA | 54.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |