C18H23F2N5S — CID 133314722
N'-(6-tert-butylimidazo[2,1-b][1,3,4]thiadiazol-2-yl)-1-(2,6-difluorophenyl)-N,N-dimethylethane-1,2-diamine (PubChem CID 133314722) has the molecular formula C18H23F2N5S and a molecular weight of 379.48 g/mol. Its IUPAC name is N'-(6-tert-butylimidazo[2,1-b][1,3,4]thiadiazol-2-yl)-1-(2,6-difluorophenyl)-N,N-dimethylethane-1,2-diamine.
| Compound Name | N'-(6-tert-butylimidazo[2,1-b][1,3,4]thiadiazol-2-yl)-1-(2,6-difluorophenyl)-N,N-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 133314722 |
| Molecular Formula | C18H23F2N5S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N'-(6-tert-butylimidazo[2,1-b][1,3,4]thiadiazol-2-yl)-1-(2,6-difluorophenyl)-N,N-dimethylethane-1,2-diamine |
| SMILES | CN(C)C(CNc1nn2cc(C(C)(C)C)nc2s1)c1c(F)cccc1F |
| InChI | InChI=1S/C18H23F2N5S/c1-18(2,3)14-10-25-17(22-14)26-16(23-25)21-9-13(24(4)5)15-11(19)7-6-8-12(15)20/h6-8,10,13H,9H2,1-5H3,(H,21,23) |
| InChIKey | WJODLTYVAZBXMD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 45.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |