C20H24N6OS — CID 133367144
6-tert-butyl-N-[phenyl-(5-propyl-1,2,4-oxadiazol-3-yl)methyl]imidazo[2,1-b][1,3,4]thiadiazol-2-amine (PubChem CID 133367144) has the molecular formula C20H24N6OS and a molecular weight of 396.52 g/mol. Its IUPAC name is 6-tert-butyl-N-[phenyl-(5-propyl-1,2,4-oxadiazol-3-yl)methyl]imidazo[2,1-b][1,3,4]thiadiazol-2-amine.
| Compound Name | 6-tert-butyl-N-[phenyl-(5-propyl-1,2,4-oxadiazol-3-yl)methyl]imidazo[2,1-b][1,3,4]thiadiazol-2-amine |
|---|---|
| PubChem CID | 133367144 |
| Molecular Formula | C20H24N6OS |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 6-tert-butyl-N-[phenyl-(5-propyl-1,2,4-oxadiazol-3-yl)methyl]imidazo[2,1-b][1,3,4]thiadiazol-2-amine |
| SMILES | CCCc1nc(C(Nc2nn3cc(C(C)(C)C)nc3s2)c2ccccc2)no1 |
| InChI | InChI=1S/C20H24N6OS/c1-5-9-15-22-17(25-27-15)16(13-10-7-6-8-11-13)23-18-24-26-12-14(20(2,3)4)21-19(26)28-18/h6-8,10-12,16H,5,9H2,1-4H3,(H,23,24) |
| InChIKey | REOXOTIISIFBHA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |