C14H25N5S — CID 133287378
N'-tert-butyl-N-(6-tert-butylimidazo[2,1-b][1,3,4]thiadiazol-2-yl)ethane-1,2-diamine (PubChem CID 133287378) has the molecular formula C14H25N5S and a molecular weight of 295.46 g/mol. Its IUPAC name is N'-tert-butyl-N-(6-tert-butylimidazo[2,1-b][1,3,4]thiadiazol-2-yl)ethane-1,2-diamine.
| Compound Name | N'-tert-butyl-N-(6-tert-butylimidazo[2,1-b][1,3,4]thiadiazol-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 133287378 |
| Molecular Formula | C14H25N5S |
| Molecular Weight | 295.46 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | N'-tert-butyl-N-(6-tert-butylimidazo[2,1-b][1,3,4]thiadiazol-2-yl)ethane-1,2-diamine |
| SMILES | CC(C)(C)NCCNc1nn2cc(C(C)(C)C)nc2s1 |
| InChI | InChI=1S/C14H25N5S/c1-13(2,3)10-9-19-12(17-10)20-11(18-19)15-7-8-16-14(4,5)6/h9,16H,7-8H2,1-6H3,(H,15,18) |
| InChIKey | KBPGIXVFMKLKTQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 54.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|