C16H24N4O — CID 114468923
2-tert-butyl-N-[2-(2-methylprop-2-enoxy)ethyl]pyrazolo[1,5-a]pyrazin-4-amine (PubChem CID 114468923) has the molecular formula C16H24N4O and a molecular weight of 288.40 g/mol. Its IUPAC name is 2-tert-butyl-N-[2-(2-methylprop-2-enoxy)ethyl]pyrazolo[1,5-a]pyrazin-4-amine.
| Compound Name | 2-tert-butyl-N-[2-(2-methylprop-2-enoxy)ethyl]pyrazolo[1,5-a]pyrazin-4-amine |
|---|---|
| PubChem CID | 114468923 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 2-tert-butyl-N-[2-(2-methylprop-2-enoxy)ethyl]pyrazolo[1,5-a]pyrazin-4-amine |
| SMILES | C=C(C)COCCNc1nccn2nc(C(C)(C)C)cc12 |
| InChI | InChI=1S/C16H24N4O/c1-12(2)11-21-9-7-18-15-13-10-14(16(3,4)5)19-20(13)8-6-17-15/h6,8,10H,1,7,9,11H2,2-5H3,(H,17,18) |
| InChIKey | UGDYZZHCAXQSQR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|