C14H21N5O2 — CID 106239775
2-[2-[(2-tert-butylpyrazolo[1,5-a]pyrazin-4-yl)amino]ethoxy]acetamide (PubChem CID 106239775) has the molecular formula C14H21N5O2 and a molecular weight of 291.36 g/mol. Its IUPAC name is 2-[2-[(2-tert-butylpyrazolo[1,5-a]pyrazin-4-yl)amino]ethoxy]acetamide.
| Compound Name | 2-[2-[(2-tert-butylpyrazolo[1,5-a]pyrazin-4-yl)amino]ethoxy]acetamide |
|---|---|
| PubChem CID | 106239775 |
| Molecular Formula | C14H21N5O2 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 2-[2-[(2-tert-butylpyrazolo[1,5-a]pyrazin-4-yl)amino]ethoxy]acetamide |
| SMILES | CC(C)(C)c1cc2c(NCCOCC(N)=O)nccn2n1 |
| InChI | InChI=1S/C14H21N5O2/c1-14(2,3)11-8-10-13(16-4-6-19(10)18-11)17-5-7-21-9-12(15)20/h4,6,8H,5,7,9H2,1-3H3,(H2,15,20)(H,16,17) |
| InChIKey | SVNJEPIOFXQPMI-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|