C12H17N5O2 — CID 104732050
2-[(2-propan-2-ylpyrazolo[1,5-a]pyrazin-4-yl)amino]ethyl carbamate (PubChem CID 104732050) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is 2-[(2-propan-2-ylpyrazolo[1,5-a]pyrazin-4-yl)amino]ethyl carbamate.
| Compound Name | 2-[(2-propan-2-ylpyrazolo[1,5-a]pyrazin-4-yl)amino]ethyl carbamate |
|---|---|
| PubChem CID | 104732050 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 2-[(2-propan-2-ylpyrazolo[1,5-a]pyrazin-4-yl)amino]ethyl carbamate |
| SMILES | CC(C)c1cc2c(NCCOC(N)=O)nccn2n1 |
| InChI | InChI=1S/C12H17N5O2/c1-8(2)9-7-10-11(14-3-5-17(10)16-9)15-4-6-19-12(13)18/h3,5,7-8H,4,6H2,1-2H3,(H2,13,18)(H,14,15) |
| InChIKey | QHIDWEYPNQNCOF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|