C14H21N5O — CID 106238782
5-[(2-propan-2-ylpyrazolo[1,5-a]pyrazin-4-yl)amino]pentanamide (PubChem CID 106238782) has the molecular formula C14H21N5O and a molecular weight of 275.36 g/mol. Its IUPAC name is 5-[(2-propan-2-ylpyrazolo[1,5-a]pyrazin-4-yl)amino]pentanamide.
| Compound Name | 5-[(2-propan-2-ylpyrazolo[1,5-a]pyrazin-4-yl)amino]pentanamide |
|---|---|
| PubChem CID | 106238782 |
| Molecular Formula | C14H21N5O |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 5-[(2-propan-2-ylpyrazolo[1,5-a]pyrazin-4-yl)amino]pentanamide |
| SMILES | CC(C)c1cc2c(NCCCCC(N)=O)nccn2n1 |
| InChI | InChI=1S/C14H21N5O/c1-10(2)11-9-12-14(17-7-8-19(12)18-11)16-6-4-3-5-13(15)20/h7-10H,3-6H2,1-2H3,(H2,15,20)(H,16,17) |
| InChIKey | YPZCNWMWXVWZAT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 85.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|