C12H18N6O — CID 104732037
2-[(2-propan-2-ylpyrazolo[1,5-a]pyrazin-4-yl)amino]ethylurea (PubChem CID 104732037) has the molecular formula C12H18N6O and a molecular weight of 262.32 g/mol. Its IUPAC name is 2-[(2-propan-2-ylpyrazolo[1,5-a]pyrazin-4-yl)amino]ethylurea.
| Compound Name | 2-[(2-propan-2-ylpyrazolo[1,5-a]pyrazin-4-yl)amino]ethylurea |
|---|---|
| PubChem CID | 104732037 |
| Molecular Formula | C12H18N6O |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 2-[(2-propan-2-ylpyrazolo[1,5-a]pyrazin-4-yl)amino]ethylurea |
| SMILES | CC(C)c1cc2c(NCCNC(N)=O)nccn2n1 |
| InChI | InChI=1S/C12H18N6O/c1-8(2)9-7-10-11(14-3-4-16-12(13)19)15-5-6-18(10)17-9/h5-8H,3-4H2,1-2H3,(H,14,15)(H3,13,16,19) |
| InChIKey | IVNDDGZKWHIQRP-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 97.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|