C13H17F3N4O — CID 104730942
N-(2-butoxyethyl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazin-4-amine (PubChem CID 104730942) has the molecular formula C13H17F3N4O and a molecular weight of 302.30 g/mol. Its IUPAC name is N-(2-butoxyethyl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazin-4-amine.
| Compound Name | N-(2-butoxyethyl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazin-4-amine |
|---|---|
| PubChem CID | 104730942 |
| Molecular Formula | C13H17F3N4O |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | N-(2-butoxyethyl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazin-4-amine |
| SMILES | CCCCOCCNc1nccn2nc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C13H17F3N4O/c1-2-3-7-21-8-5-18-12-10-9-11(13(14,15)16)19-20(10)6-4-17-12/h4,6,9H,2-3,5,7-8H2,1H3,(H,17,18) |
| InChIKey | GOUUCDKVCPCYFK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|