C12H16F3N5O — CID 104732852
N-(2-methoxyethyl)-N'-[2-(trifluoromethyl)pyrazolo[1,5-a]pyrazin-4-yl]ethane-1,2-diamine (PubChem CID 104732852) has the molecular formula C12H16F3N5O and a molecular weight of 303.29 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N'-[2-(trifluoromethyl)pyrazolo[1,5-a]pyrazin-4-yl]ethane-1,2-diamine.
| Compound Name | N-(2-methoxyethyl)-N'-[2-(trifluoromethyl)pyrazolo[1,5-a]pyrazin-4-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 104732852 |
| Molecular Formula | C12H16F3N5O |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | N-(2-methoxyethyl)-N'-[2-(trifluoromethyl)pyrazolo[1,5-a]pyrazin-4-yl]ethane-1,2-diamine |
| SMILES | COCCNCCNc1nccn2nc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C12H16F3N5O/c1-21-7-5-16-2-3-17-11-9-8-10(12(13,14)15)19-20(9)6-4-18-11/h4,6,8,16H,2-3,5,7H2,1H3,(H,17,18) |
| InChIKey | UNXWUGAKLKQSSX-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 63.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|