C14H19F3N4 — CID 104731951
N-(5-methylhexyl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazin-4-amine (PubChem CID 104731951) has the molecular formula C14H19F3N4 and a molecular weight of 300.33 g/mol. Its IUPAC name is N-(5-methylhexyl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazin-4-amine.
| Compound Name | N-(5-methylhexyl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazin-4-amine |
|---|---|
| PubChem CID | 104731951 |
| Molecular Formula | C14H19F3N4 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N-(5-methylhexyl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazin-4-amine |
| SMILES | CC(C)CCCCNc1nccn2nc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C14H19F3N4/c1-10(2)5-3-4-6-18-13-11-9-12(14(15,16)17)20-21(11)8-7-19-13/h7-10H,3-6H2,1-2H3,(H,18,19) |
| InChIKey | GJXWLAVGMGEJAG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|