C12H15F3N4O — CID 104731181
N-(4-methoxybutyl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazin-4-amine (PubChem CID 104731181) has the molecular formula C12H15F3N4O and a molecular weight of 288.27 g/mol. Its IUPAC name is N-(4-methoxybutyl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazin-4-amine.
| Compound Name | N-(4-methoxybutyl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazin-4-amine |
|---|---|
| PubChem CID | 104731181 |
| Molecular Formula | C12H15F3N4O |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | N-(4-methoxybutyl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazin-4-amine |
| SMILES | COCCCCNc1nccn2nc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C12H15F3N4O/c1-20-7-3-2-4-16-11-9-8-10(12(13,14)15)18-19(9)6-5-17-11/h5-6,8H,2-4,7H2,1H3,(H,16,17) |
| InChIKey | MJRDXZJICIDHGA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|