C15H25N5 — CID 107323432
N'-(2-tert-butylpyrazolo[1,5-a]pyrazin-4-yl)pentane-1,5-diamine (PubChem CID 107323432) has the molecular formula C15H25N5 and a molecular weight of 275.40 g/mol. Its IUPAC name is N'-(2-tert-butylpyrazolo[1,5-a]pyrazin-4-yl)pentane-1,5-diamine.
| Compound Name | N'-(2-tert-butylpyrazolo[1,5-a]pyrazin-4-yl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 107323432 |
| Molecular Formula | C15H25N5 |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.21 |
| IUPAC Name | N'-(2-tert-butylpyrazolo[1,5-a]pyrazin-4-yl)pentane-1,5-diamine |
| SMILES | CC(C)(C)c1cc2c(NCCCCCN)nccn2n1 |
| InChI | InChI=1S/C15H25N5/c1-15(2,3)13-11-12-14(17-8-6-4-5-7-16)18-9-10-20(12)19-13/h9-11H,4-8,16H2,1-3H3,(H,17,18) |
| InChIKey | AWCIWCJRFRNMKD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|