About 2-tert-butyl-N-(2,2-difluoroethyl)pyrazolo[1,5-a]pyrazin-4-amine
2-tert-butyl-N-(2,2-difluoroethyl)pyrazolo[1,5-a]pyrazin-4-amine (PubChem CID 113446406) has the molecular formula C12H16F2N4
and a molecular weight of 254.28 g/mol. Its IUPAC name is 2-tert-butyl-N-(2,2-difluoroethyl)pyrazolo[1,5-a]pyrazin-4-amine.
Molecular Properties
| Compound Name | 2-tert-butyl-N-(2,2-difluoroethyl)pyrazolo[1,5-a]pyrazin-4-amine |
| PubChem CID | 113446406 |
| Molecular Formula | C12H16F2N4 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 2-tert-butyl-N-(2,2-difluoroethyl)pyrazolo[1,5-a]pyrazin-4-amine |
| SMILES | CC(C)(C)c1cc2c(NCC(F)F)nccn2n1 |
| InChI | InChI=1S/C12H16F2N4/c1-12(2,3)9-6-8-11(16-7-10(13)14)15-4-5-18(8)17-9/h4-6,10H,7H2,1-3H3,(H,15,16) |
| InChIKey | IFNSXBRWCNDGSB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-tert-butyl-N-(2,2-difluoroethyl)pyrazolo[1,5-a]pyrazin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-N-(2,2-difluoroethyl)pyrazolo[1,5-a]pyrazin-4-amine?
The IUPAC name of 2-tert-butyl-N-(2,2-difluoroethyl)pyrazolo[1,5-a]pyrazin-4-amine (CID 113446406) is 2-tert-butyl-N-(2,2-difluoroethyl)pyrazolo[1,5-a]pyrazin-4-amine.
What is the SMILES notation for 2-tert-butyl-N-(2,2-difluoroethyl)pyrazolo[1,5-a]pyrazin-4-amine?
The canonical SMILES for 2-tert-butyl-N-(2,2-difluoroethyl)pyrazolo[1,5-a]pyrazin-4-amine is CC(C)(C)c1cc2c(NCC(F)F)nccn2n1.
What is the InChIKey of 2-tert-butyl-N-(2,2-difluoroethyl)pyrazolo[1,5-a]pyrazin-4-amine?
The InChIKey is IFNSXBRWCNDGSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F2N4/c1-12(2,3)9-6-8-11(16-7-10(13)14)15-4-5-18(8)17-9/h4-6,10H,7H2,1-3H3,(H,15,16).
What are the key properties of 2-tert-butyl-N-(2,2-difluoroethyl)pyrazolo[1,5-a]pyrazin-4-amine?
2-tert-butyl-N-(2,2-difluoroethyl)pyrazolo[1,5-a]pyrazin-4-amine has a molecular weight of 254.28 g/mol, XLogP of 2.70, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-N-(2,2-difluoroethyl)pyrazolo[1,5-a]pyrazin-4-amine is sourced from PubChem (CID 113446406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).