C12H17ClN4 — CID 104733907
2-tert-butyl-N-(2-chloroethyl)pyrazolo[1,5-a]pyrazin-4-amine (PubChem CID 104733907) has the molecular formula C12H17ClN4 and a molecular weight of 252.75 g/mol. Its IUPAC name is 2-tert-butyl-N-(2-chloroethyl)pyrazolo[1,5-a]pyrazin-4-amine.
| Compound Name | 2-tert-butyl-N-(2-chloroethyl)pyrazolo[1,5-a]pyrazin-4-amine |
|---|---|
| PubChem CID | 104733907 |
| Molecular Formula | C12H17ClN4 |
| Molecular Weight | 252.75 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 2-tert-butyl-N-(2-chloroethyl)pyrazolo[1,5-a]pyrazin-4-amine |
| SMILES | CC(C)(C)c1cc2c(NCCCl)nccn2n1 |
| InChI | InChI=1S/C12H17ClN4/c1-12(2,3)10-8-9-11(14-5-4-13)15-6-7-17(9)16-10/h6-8H,4-5H2,1-3H3,(H,14,15) |
| InChIKey | SPIVVJYQQZESPF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.75 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|