C11H15ClN4 — CID 106845051
N-(4-chlorobutyl)-2-methylpyrazolo[1,5-a]pyrazin-4-amine (PubChem CID 106845051) has the molecular formula C11H15ClN4 and a molecular weight of 238.72 g/mol. Its IUPAC name is N-(4-chlorobutyl)-2-methylpyrazolo[1,5-a]pyrazin-4-amine.
| Compound Name | N-(4-chlorobutyl)-2-methylpyrazolo[1,5-a]pyrazin-4-amine |
|---|---|
| PubChem CID | 106845051 |
| Molecular Formula | C11H15ClN4 |
| Molecular Weight | 238.72 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | N-(4-chlorobutyl)-2-methylpyrazolo[1,5-a]pyrazin-4-amine |
| SMILES | Cc1cc2c(NCCCCCl)nccn2n1 |
| InChI | InChI=1S/C11H15ClN4/c1-9-8-10-11(13-5-3-2-4-12)14-6-7-16(10)15-9/h6-8H,2-5H2,1H3,(H,13,14) |
| InChIKey | DPFQGQDFEPWYJK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.72 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|