C11H14Cl2N4 — CID 104734163
N-(1,3-dichloro-2-methylpropan-2-yl)-2-methylpyrazolo[1,5-a]pyrazin-4-amine (PubChem CID 104734163) has the molecular formula C11H14Cl2N4 and a molecular weight of 273.17 g/mol. Its IUPAC name is N-(1,3-dichloro-2-methylpropan-2-yl)-2-methylpyrazolo[1,5-a]pyrazin-4-amine.
| Compound Name | N-(1,3-dichloro-2-methylpropan-2-yl)-2-methylpyrazolo[1,5-a]pyrazin-4-amine |
|---|---|
| PubChem CID | 104734163 |
| Molecular Formula | C11H14Cl2N4 |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | N-(1,3-dichloro-2-methylpropan-2-yl)-2-methylpyrazolo[1,5-a]pyrazin-4-amine |
| SMILES | Cc1cc2c(NC(C)(CCl)CCl)nccn2n1 |
| InChI | InChI=1S/C11H14Cl2N4/c1-8-5-9-10(14-3-4-17(9)16-8)15-11(2,6-12)7-13/h3-5H,6-7H2,1-2H3,(H,14,15) |
| InChIKey | ADCZPFCZTDDBGJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|