About 2-tert-butyl-N-[3-(chloromethyl)pentan-3-yl]pyrazolo[1,5-a]pyrazin-4-amine
2-tert-butyl-N-[3-(chloromethyl)pentan-3-yl]pyrazolo[1,5-a]pyrazin-4-amine (PubChem CID 104733983) has the molecular formula C16H25ClN4
and a molecular weight of 308.86 g/mol. Its IUPAC name is 2-tert-butyl-N-[3-(chloromethyl)pentan-3-yl]pyrazolo[1,5-a]pyrazin-4-amine.
Molecular Properties
| Compound Name | 2-tert-butyl-N-[3-(chloromethyl)pentan-3-yl]pyrazolo[1,5-a]pyrazin-4-amine |
| PubChem CID | 104733983 |
| Molecular Formula | C16H25ClN4 |
| Molecular Weight | 308.86 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 2-tert-butyl-N-[3-(chloromethyl)pentan-3-yl]pyrazolo[1,5-a]pyrazin-4-amine |
| SMILES | CCC(CC)(CCl)Nc1nccn2nc(C(C)(C)C)cc12 |
| InChI | InChI=1S/C16H25ClN4/c1-6-16(7-2,11-17)19-14-12-10-13(15(3,4)5)20-21(12)9-8-18-14/h8-10H,6-7,11H2,1-5H3,(H,18,19) |
| InChIKey | KGBZYSPPWFJGQD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.86 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-N-[3-(chloromethyl)pentan-3-yl]pyrazolo[1,5-a]pyrazin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-N-[3-(chloromethyl)pentan-3-yl]pyrazolo[1,5-a]pyrazin-4-amine?
The IUPAC name of 2-tert-butyl-N-[3-(chloromethyl)pentan-3-yl]pyrazolo[1,5-a]pyrazin-4-amine (CID 104733983) is 2-tert-butyl-N-[3-(chloromethyl)pentan-3-yl]pyrazolo[1,5-a]pyrazin-4-amine.
What is the SMILES notation for 2-tert-butyl-N-[3-(chloromethyl)pentan-3-yl]pyrazolo[1,5-a]pyrazin-4-amine?
The canonical SMILES for 2-tert-butyl-N-[3-(chloromethyl)pentan-3-yl]pyrazolo[1,5-a]pyrazin-4-amine is CCC(CC)(CCl)Nc1nccn2nc(C(C)(C)C)cc12.
What is the InChIKey of 2-tert-butyl-N-[3-(chloromethyl)pentan-3-yl]pyrazolo[1,5-a]pyrazin-4-amine?
The InChIKey is KGBZYSPPWFJGQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25ClN4/c1-6-16(7-2,11-17)19-14-12-10-13(15(3,4)5)20-21(12)9-8-18-14/h8-10H,6-7,11H2,1-5H3,(H,18,19).
What are the key properties of 2-tert-butyl-N-[3-(chloromethyl)pentan-3-yl]pyrazolo[1,5-a]pyrazin-4-amine?
2-tert-butyl-N-[3-(chloromethyl)pentan-3-yl]pyrazolo[1,5-a]pyrazin-4-amine has a molecular weight of 308.86 g/mol, XLogP of 4.24, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-N-[3-(chloromethyl)pentan-3-yl]pyrazolo[1,5-a]pyrazin-4-amine is sourced from PubChem (CID 104733983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).