C16H25N5 — CID 104732568
N-(azepan-3-yl)-2-tert-butylpyrazolo[1,5-a]pyrazin-4-amine (PubChem CID 104732568) has the molecular formula C16H25N5 and a molecular weight of 287.41 g/mol. Its IUPAC name is N-(azepan-3-yl)-2-tert-butylpyrazolo[1,5-a]pyrazin-4-amine.
| Compound Name | N-(azepan-3-yl)-2-tert-butylpyrazolo[1,5-a]pyrazin-4-amine |
|---|---|
| PubChem CID | 104732568 |
| Molecular Formula | C16H25N5 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | N-(azepan-3-yl)-2-tert-butylpyrazolo[1,5-a]pyrazin-4-amine |
| SMILES | CC(C)(C)c1cc2c(NC3CCCCNC3)nccn2n1 |
| InChI | InChI=1S/C16H25N5/c1-16(2,3)14-10-13-15(18-8-9-21(13)20-14)19-12-6-4-5-7-17-11-12/h8-10,12,17H,4-7,11H2,1-3H3,(H,18,19) |
| InChIKey | PWCKRDIQLNQDHR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 54.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |