C15H20N4 — CID 106231271
2-tert-butyl-N-pent-1-yn-3-ylpyrazolo[1,5-a]pyrazin-4-amine (PubChem CID 106231271) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is 2-tert-butyl-N-pent-1-yn-3-ylpyrazolo[1,5-a]pyrazin-4-amine.
| Compound Name | 2-tert-butyl-N-pent-1-yn-3-ylpyrazolo[1,5-a]pyrazin-4-amine |
|---|---|
| PubChem CID | 106231271 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 2-tert-butyl-N-pent-1-yn-3-ylpyrazolo[1,5-a]pyrazin-4-amine |
| SMILES | C#CC(CC)Nc1nccn2nc(C(C)(C)C)cc12 |
| InChI | InChI=1S/C15H20N4/c1-6-11(7-2)17-14-12-10-13(15(3,4)5)18-19(12)9-8-16-14/h1,8-11H,7H2,2-5H3,(H,16,17) |
| InChIKey | DPRLKTLVYUSDJO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|