C12H15F3N4 — CID 104731976
2-methyl-N-(5,5,5-trifluoropentyl)pyrazolo[1,5-a]pyrazin-4-amine (PubChem CID 104731976) has the molecular formula C12H15F3N4 and a molecular weight of 272.27 g/mol. Its IUPAC name is 2-methyl-N-(5,5,5-trifluoropentyl)pyrazolo[1,5-a]pyrazin-4-amine.
| Compound Name | 2-methyl-N-(5,5,5-trifluoropentyl)pyrazolo[1,5-a]pyrazin-4-amine |
|---|---|
| PubChem CID | 104731976 |
| Molecular Formula | C12H15F3N4 |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-methyl-N-(5,5,5-trifluoropentyl)pyrazolo[1,5-a]pyrazin-4-amine |
| SMILES | Cc1cc2c(NCCCCC(F)(F)F)nccn2n1 |
| InChI | InChI=1S/C12H15F3N4/c1-9-8-10-11(17-6-7-19(10)18-9)16-5-3-2-4-12(13,14)15/h6-8H,2-5H2,1H3,(H,16,17) |
| InChIKey | IZYXVXMBPKIKIV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|