C12H18N4O — CID 104762381
2-methyl-N-(2-propan-2-yloxyethyl)pyrazolo[1,5-a]pyrazin-4-amine (PubChem CID 104762381) has the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. Its IUPAC name is 2-methyl-N-(2-propan-2-yloxyethyl)pyrazolo[1,5-a]pyrazin-4-amine.
| Compound Name | 2-methyl-N-(2-propan-2-yloxyethyl)pyrazolo[1,5-a]pyrazin-4-amine |
|---|---|
| PubChem CID | 104762381 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 2-methyl-N-(2-propan-2-yloxyethyl)pyrazolo[1,5-a]pyrazin-4-amine |
| SMILES | Cc1cc2c(NCCOC(C)C)nccn2n1 |
| InChI | InChI=1S/C12H18N4O/c1-9(2)17-7-5-14-12-11-8-10(3)15-16(11)6-4-13-12/h4,6,8-9H,5,7H2,1-3H3,(H,13,14) |
| InChIKey | UZOSLICXCNRIDO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|