C9H17N3O3S — CID 107271218
N-(4-hydroxypentyl)-5-methyl-1H-pyrazole-4-sulfonamide (PubChem CID 107271218) has the molecular formula C9H17N3O3S and a molecular weight of 247.32 g/mol. Its IUPAC name is N-(4-hydroxypentyl)-5-methyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-(4-hydroxypentyl)-5-methyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 107271218 |
| Molecular Formula | C9H17N3O3S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | N-(4-hydroxypentyl)-5-methyl-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1[nH]ncc1S(=O)(=O)NCCCC(C)O |
| InChI | InChI=1S/C9H17N3O3S/c1-7(13)4-3-5-11-16(14,15)9-6-10-12-8(9)2/h6-7,11,13H,3-5H2,1-2H3,(H,10,12) |
| InChIKey | SDSXNSIBQHPEAT-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|