C7H13N5O3S — CID 78994022
2-[(5-methyl-1H-pyrazol-4-yl)sulfonylamino]ethylurea (PubChem CID 78994022) has the molecular formula C7H13N5O3S and a molecular weight of 247.28 g/mol. Its IUPAC name is 2-[(5-methyl-1H-pyrazol-4-yl)sulfonylamino]ethylurea.
| Compound Name | 2-[(5-methyl-1H-pyrazol-4-yl)sulfonylamino]ethylurea |
|---|---|
| PubChem CID | 78994022 |
| Molecular Formula | C7H13N5O3S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 2-[(5-methyl-1H-pyrazol-4-yl)sulfonylamino]ethylurea |
| SMILES | Cc1[nH]ncc1S(=O)(=O)NCCNC(N)=O |
| InChI | InChI=1S/C7H13N5O3S/c1-5-6(4-10-12-5)16(14,15)11-3-2-9-7(8)13/h4,11H,2-3H2,1H3,(H,10,12)(H3,8,9,13) |
| InChIKey | DRLHFSNIUUHXMH-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 129.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|