C8H14BrN3O2S — CID 114298151
N-(3-bromo-2-methylpropyl)-5-methyl-1H-pyrazole-4-sulfonamide (PubChem CID 114298151) has the molecular formula C8H14BrN3O2S and a molecular weight of 296.19 g/mol. Its IUPAC name is N-(3-bromo-2-methylpropyl)-5-methyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-(3-bromo-2-methylpropyl)-5-methyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 114298151 |
| Molecular Formula | C8H14BrN3O2S |
| Molecular Weight | 296.19 g/mol |
| Exact Mass | 295.00 |
| IUPAC Name | N-(3-bromo-2-methylpropyl)-5-methyl-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1[nH]ncc1S(=O)(=O)NCC(C)CBr |
| InChI | InChI=1S/C8H14BrN3O2S/c1-6(3-9)4-11-15(13,14)8-5-10-12-7(8)2/h5-6,11H,3-4H2,1-2H3,(H,10,12) |
| InChIKey | ABYLUSTTZJVFMJ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.19 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|