C11H20ClN3O2S — CID 106288856
N-(2-chloro-3-ethylpentyl)-5-methyl-1H-pyrazole-4-sulfonamide (PubChem CID 106288856) has the molecular formula C11H20ClN3O2S and a molecular weight of 293.82 g/mol. Its IUPAC name is N-(2-chloro-3-ethylpentyl)-5-methyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-(2-chloro-3-ethylpentyl)-5-methyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106288856 |
| Molecular Formula | C11H20ClN3O2S |
| Molecular Weight | 293.82 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | N-(2-chloro-3-ethylpentyl)-5-methyl-1H-pyrazole-4-sulfonamide |
| SMILES | CCC(CC)C(Cl)CNS(=O)(=O)c1cn[nH]c1C |
| InChI | InChI=1S/C11H20ClN3O2S/c1-4-9(5-2)10(12)6-14-18(16,17)11-7-13-15-8(11)3/h7,9-10,14H,4-6H2,1-3H3,(H,13,15) |
| InChIKey | LRQPYOYFZWPQKK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.82 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|