C11H18N4O3S — CID 78954154
N-cyclopropyl-4-[(5-methyl-1H-pyrazol-4-yl)sulfonylamino]butanamide (PubChem CID 78954154) has the molecular formula C11H18N4O3S and a molecular weight of 286.36 g/mol. Its IUPAC name is N-cyclopropyl-4-[(5-methyl-1H-pyrazol-4-yl)sulfonylamino]butanamide.
| Compound Name | N-cyclopropyl-4-[(5-methyl-1H-pyrazol-4-yl)sulfonylamino]butanamide |
|---|---|
| PubChem CID | 78954154 |
| Molecular Formula | C11H18N4O3S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | N-cyclopropyl-4-[(5-methyl-1H-pyrazol-4-yl)sulfonylamino]butanamide |
| SMILES | Cc1[nH]ncc1S(=O)(=O)NCCCC(=O)NC1CC1 |
| InChI | InChI=1S/C11H18N4O3S/c1-8-10(7-12-15-8)19(17,18)13-6-2-3-11(16)14-9-4-5-9/h7,9,13H,2-6H2,1H3,(H,12,15)(H,14,16) |
| InChIKey | VRAJAUPWCBCZJQ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|