C11H17N3O4S2 — CID 79395251
N-cyclopropyl-4-[(4-methyl-2-oxo-3H-1,3-thiazol-5-yl)sulfonylamino]butanamide (PubChem CID 79395251) has the molecular formula C11H17N3O4S2 and a molecular weight of 319.41 g/mol. Its IUPAC name is N-cyclopropyl-4-[(4-methyl-2-oxo-3H-1,3-thiazol-5-yl)sulfonylamino]butanamide.
| Compound Name | N-cyclopropyl-4-[(4-methyl-2-oxo-3H-1,3-thiazol-5-yl)sulfonylamino]butanamide |
|---|---|
| PubChem CID | 79395251 |
| Molecular Formula | C11H17N3O4S2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | N-cyclopropyl-4-[(4-methyl-2-oxo-3H-1,3-thiazol-5-yl)sulfonylamino]butanamide |
| SMILES | Cc1[nH]c(=O)sc1S(=O)(=O)NCCCC(=O)NC1CC1 |
| InChI | InChI=1S/C11H17N3O4S2/c1-7-10(19-11(16)13-7)20(17,18)12-6-2-3-9(15)14-8-4-5-8/h8,12H,2-6H2,1H3,(H,13,16)(H,14,15) |
| InChIKey | PQXYIRCNXISBHX-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|