C10H14N2O3S2 — CID 106213763
N-hex-5-ynyl-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide (PubChem CID 106213763) has the molecular formula C10H14N2O3S2 and a molecular weight of 274.37 g/mol. Its IUPAC name is N-hex-5-ynyl-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide.
| Compound Name | N-hex-5-ynyl-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 106213763 |
| Molecular Formula | C10H14N2O3S2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | N-hex-5-ynyl-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide |
| SMILES | C#CCCCCNS(=O)(=O)c1sc(=O)[nH]c1C |
| InChI | InChI=1S/C10H14N2O3S2/c1-3-4-5-6-7-11-17(14,15)9-8(2)12-10(13)16-9/h1,11H,4-7H2,2H3,(H,12,13) |
| InChIKey | FWXUEKRJBIPCFX-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|