C11H18N2O5S2 — CID 43244912
7-[(4-methyl-2-oxo-3H-1,3-thiazol-5-yl)sulfonylamino]heptanoic acid (PubChem CID 43244912) has the molecular formula C11H18N2O5S2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 7-[(4-methyl-2-oxo-3H-1,3-thiazol-5-yl)sulfonylamino]heptanoic acid.
| Compound Name | 7-[(4-methyl-2-oxo-3H-1,3-thiazol-5-yl)sulfonylamino]heptanoic acid |
|---|---|
| PubChem CID | 43244912 |
| Molecular Formula | C11H18N2O5S2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 7-[(4-methyl-2-oxo-3H-1,3-thiazol-5-yl)sulfonylamino]heptanoic acid |
| SMILES | Cc1[nH]c(=O)sc1S(=O)(=O)NCCCCCCC(=O)O |
| InChI | InChI=1S/C11H18N2O5S2/c1-8-10(19-11(16)13-8)20(17,18)12-7-5-3-2-4-6-9(14)15/h12H,2-7H2,1H3,(H,13,16)(H,14,15) |
| InChIKey | BVHQCSJRVDBTLJ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|