C4H6N2O4S2 — CID 130964713
N-hydroxy-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide (PubChem CID 130964713) has the molecular formula C4H6N2O4S2 and a molecular weight of 210.24 g/mol. Its IUPAC name is N-hydroxy-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide.
| Compound Name | N-hydroxy-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 130964713 |
| Molecular Formula | C4H6N2O4S2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 209.98 |
| IUPAC Name | N-hydroxy-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1[nH]c(=O)sc1S(=O)(=O)NO |
| InChI | InChI=1S/C4H6N2O4S2/c1-2-3(11-4(7)5-2)12(9,10)6-8/h6,8H,1H3,(H,5,7) |
| InChIKey | MVRXBCHODHSFNB-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|