C9H12N2O3S2 — CID 106222743
4-methyl-2-oxo-N-pent-4-ynyl-3H-1,3-thiazole-5-sulfonamide (PubChem CID 106222743) has the molecular formula C9H12N2O3S2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 4-methyl-2-oxo-N-pent-4-ynyl-3H-1,3-thiazole-5-sulfonamide.
| Compound Name | 4-methyl-2-oxo-N-pent-4-ynyl-3H-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 106222743 |
| Molecular Formula | C9H12N2O3S2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 4-methyl-2-oxo-N-pent-4-ynyl-3H-1,3-thiazole-5-sulfonamide |
| SMILES | C#CCCCNS(=O)(=O)c1sc(=O)[nH]c1C |
| InChI | InChI=1S/C9H12N2O3S2/c1-3-4-5-6-10-16(13,14)8-7(2)11-9(12)15-8/h1,10H,4-6H2,2H3,(H,11,12) |
| InChIKey | LDVFNMFIAQZNIT-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|