C22H23NO4S — CID 90524456
3-(benzenesulfonyl)-N-(3-hydroxy-3-naphthalen-1-ylpropyl)propanamide (PubChem CID 90524456) has the molecular formula C22H23NO4S and a molecular weight of 397.50 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-N-(3-hydroxy-3-naphthalen-1-ylpropyl)propanamide.
| Compound Name | 3-(benzenesulfonyl)-N-(3-hydroxy-3-naphthalen-1-ylpropyl)propanamide |
|---|---|
| PubChem CID | 90524456 |
| Molecular Formula | C22H23NO4S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 3-(benzenesulfonyl)-N-(3-hydroxy-3-naphthalen-1-ylpropyl)propanamide |
| SMILES | O=C(CCS(=O)(=O)c1ccccc1)NCCC(O)c1cccc2ccccc12 |
| InChI | InChI=1S/C22H23NO4S/c24-21(20-12-6-8-17-7-4-5-11-19(17)20)13-15-23-22(25)14-16-28(26,27)18-9-2-1-3-10-18/h1-12,21,24H,13-16H2,(H,23,25) |
| InChIKey | NGPSIQZKAKVGCX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |