C16H26N2O3S — CID 119778978
3-amino-N-[2-(4-tert-butylphenyl)sulfonylethyl]butanamide (PubChem CID 119778978) has the molecular formula C16H26N2O3S and a molecular weight of 326.46 g/mol. Its IUPAC name is 3-amino-N-[2-(4-tert-butylphenyl)sulfonylethyl]butanamide.
| Compound Name | 3-amino-N-[2-(4-tert-butylphenyl)sulfonylethyl]butanamide |
|---|---|
| PubChem CID | 119778978 |
| Molecular Formula | C16H26N2O3S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 3-amino-N-[2-(4-tert-butylphenyl)sulfonylethyl]butanamide |
| SMILES | CC(N)CC(=O)NCCS(=O)(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H26N2O3S/c1-12(17)11-15(19)18-9-10-22(20,21)14-7-5-13(6-8-14)16(2,3)4/h5-8,12H,9-11,17H2,1-4H3,(H,18,19) |
| InChIKey | UWVBDHZMAWZUIN-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |