C12H18ClFN2O3S — CID 119814314
3-amino-N-[2-(4-fluorophenyl)sulfonylethyl]butanamide;hydrochloride (PubChem CID 119814314) has the molecular formula C12H18ClFN2O3S and a molecular weight of 324.81 g/mol. Its IUPAC name is 3-amino-N-[2-(4-fluorophenyl)sulfonylethyl]butanamide;hydrochloride.
| Compound Name | 3-amino-N-[2-(4-fluorophenyl)sulfonylethyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119814314 |
| Molecular Formula | C12H18ClFN2O3S |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 3-amino-N-[2-(4-fluorophenyl)sulfonylethyl]butanamide;hydrochloride |
| SMILES | CC(N)CC(=O)NCCS(=O)(=O)c1ccc(F)cc1.Cl |
| InChI | InChI=1S/C12H17FN2O3S.ClH/c1-9(14)8-12(16)15-6-7-19(17,18)11-4-2-10(13)3-5-11;/h2-5,9H,6-8,14H2,1H3,(H,15,16);1H |
| InChIKey | UYGPHBIDWMNFRE-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |