C17H17ClFNO5S2 — CID 95348488
(2S)-N-[2-(4-chlorophenyl)sulfonylethyl]-2-(4-fluorophenyl)sulfonylpropanamide (PubChem CID 95348488) has the molecular formula C17H17ClFNO5S2 and a molecular weight of 433.91 g/mol. Its IUPAC name is (2S)-N-[2-(4-chlorophenyl)sulfonylethyl]-2-(4-fluorophenyl)sulfonylpropanamide.
| Compound Name | (2S)-N-[2-(4-chlorophenyl)sulfonylethyl]-2-(4-fluorophenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 95348488 |
| Molecular Formula | C17H17ClFNO5S2 |
| Molecular Weight | 433.91 g/mol |
| Exact Mass | 433.02 |
| IUPAC Name | (2S)-N-[2-(4-chlorophenyl)sulfonylethyl]-2-(4-fluorophenyl)sulfonylpropanamide |
| SMILES | C[C@@H](C(=O)NCCS(=O)(=O)c1ccc(Cl)cc1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H17ClFNO5S2/c1-12(27(24,25)16-8-4-14(19)5-9-16)17(21)20-10-11-26(22,23)15-6-2-13(18)3-7-15/h2-9,12H,10-11H2,1H3,(H,20,21)/t12-/m0/s1 |
| InChIKey | PPRAATHFJFDYBK-LBPRGKRZSA-N |
| XLogP | 2.23 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.91 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |