C15H12Cl2FNO3S — CID 55811044
N-(2,3-dichlorophenyl)-2-(4-fluorophenyl)sulfonylpropanamide (PubChem CID 55811044) has the molecular formula C15H12Cl2FNO3S and a molecular weight of 376.24 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-(4-fluorophenyl)sulfonylpropanamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-(4-fluorophenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 55811044 |
| Molecular Formula | C15H12Cl2FNO3S |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 374.99 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-(4-fluorophenyl)sulfonylpropanamide |
| SMILES | CC(C(=O)Nc1cccc(Cl)c1Cl)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H12Cl2FNO3S/c1-9(23(21,22)11-7-5-10(18)6-8-11)15(20)19-13-4-2-3-12(16)14(13)17/h2-9H,1H3,(H,19,20) |
| InChIKey | LGEKXLHEPUKGKO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |