C18H18ClFN2O5S — CID 43005498
N'-[3-(4-chlorophenyl)sulfonylpropanoyl]-2-(4-fluorophenoxy)propanehydrazide (PubChem CID 43005498) has the molecular formula C18H18ClFN2O5S and a molecular weight of 428.87 g/mol. Its IUPAC name is N'-[3-(4-chlorophenyl)sulfonylpropanoyl]-2-(4-fluorophenoxy)propanehydrazide.
| Compound Name | N'-[3-(4-chlorophenyl)sulfonylpropanoyl]-2-(4-fluorophenoxy)propanehydrazide |
|---|---|
| PubChem CID | 43005498 |
| Molecular Formula | C18H18ClFN2O5S |
| Molecular Weight | 428.87 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | N'-[3-(4-chlorophenyl)sulfonylpropanoyl]-2-(4-fluorophenoxy)propanehydrazide |
| SMILES | CC(Oc1ccc(F)cc1)C(=O)NNC(=O)CCS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H18ClFN2O5S/c1-12(27-15-6-4-14(20)5-7-15)18(24)22-21-17(23)10-11-28(25,26)16-8-2-13(19)3-9-16/h2-9,12H,10-11H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | YANPIGIOTKEDPF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.87 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|