C18H20FN3O6S — CID 24638338
N-[2-[2-[2-(4-fluorophenoxy)propanoyl]hydrazinyl]-2-oxoethyl]-4-methoxybenzenesulfonamide (PubChem CID 24638338) has the molecular formula C18H20FN3O6S and a molecular weight of 425.44 g/mol. Its IUPAC name is N-[2-[2-[2-(4-fluorophenoxy)propanoyl]hydrazinyl]-2-oxoethyl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[2-[2-[2-(4-fluorophenoxy)propanoyl]hydrazinyl]-2-oxoethyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 24638338 |
| Molecular Formula | C18H20FN3O6S |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | N-[2-[2-[2-(4-fluorophenoxy)propanoyl]hydrazinyl]-2-oxoethyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCC(=O)NNC(=O)C(C)Oc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H20FN3O6S/c1-12(28-15-5-3-13(19)4-6-15)18(24)22-21-17(23)11-20-29(25,26)16-9-7-14(27-2)8-10-16/h3-10,12,20H,11H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | ALIYGPZRXQPYJL-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|