C19H18ClN3O5S — CID 4848882
N'-[3-(4-chlorophenyl)sulfonylpropanoyl]-2-(4-cyanophenoxy)propanehydrazide (PubChem CID 4848882) has the molecular formula C19H18ClN3O5S and a molecular weight of 435.89 g/mol. Its IUPAC name is N'-[3-(4-chlorophenyl)sulfonylpropanoyl]-2-(4-cyanophenoxy)propanehydrazide.
| Compound Name | N'-[3-(4-chlorophenyl)sulfonylpropanoyl]-2-(4-cyanophenoxy)propanehydrazide |
|---|---|
| PubChem CID | 4848882 |
| Molecular Formula | C19H18ClN3O5S |
| Molecular Weight | 435.89 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | N'-[3-(4-chlorophenyl)sulfonylpropanoyl]-2-(4-cyanophenoxy)propanehydrazide |
| SMILES | CC(Oc1ccc(C#N)cc1)C(=O)NNC(=O)CCS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H18ClN3O5S/c1-13(28-16-6-2-14(12-21)3-7-16)19(25)23-22-18(24)10-11-29(26,27)17-8-4-15(20)5-9-17/h2-9,13H,10-11H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | ATQABCSMWOECDR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 125.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.89 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|